C12H17F2NO3S — CID 54920813
methyl 4-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]butanoate (PubChem CID 54920813) has the molecular formula C12H17F2NO3S and a molecular weight of 293.33 g/mol. Its IUPAC name is methyl 4-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]butanoate.
| Compound Name | methyl 4-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]butanoate |
|---|---|
| PubChem CID | 54920813 |
| Molecular Formula | C12H17F2NO3S |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | methyl 4-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]butanoate |
| SMILES | COC(=O)CCCNCc1ccc(CSC(F)F)o1 |
| InChI | InChI=1S/C12H17F2NO3S/c1-17-11(16)3-2-6-15-7-9-4-5-10(18-9)8-19-12(13)14/h4-5,12,15H,2-3,6-8H2,1H3 |
| InChIKey | NJVPESCRMAATBH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|