C17H21F2NO3S — CID 119108718
N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine (PubChem CID 119108718) has the molecular formula C17H21F2NO3S and a molecular weight of 357.42 g/mol. Its IUPAC name is N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine.
| Compound Name | N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 119108718 |
| Molecular Formula | C17H21F2NO3S |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
| SMILES | COc1ccc(CCNCc2ccc(CSC(F)F)o2)cc1OC |
| InChI | InChI=1S/C17H21F2NO3S/c1-21-15-6-3-12(9-16(15)22-2)7-8-20-10-13-4-5-14(23-13)11-24-17(18)19/h3-6,9,17,20H,7-8,10-11H2,1-2H3 |
| InChIKey | OUWIHAHBACFVDO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|