C18H23NO7 — CID 17053061
2-(3,4-dimethoxyphenyl)-N-[(5-methylfuran-2-yl)methyl]ethanamine;oxalic acid (PubChem CID 17053061) has the molecular formula C18H23NO7 and a molecular weight of 365.38 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[(5-methylfuran-2-yl)methyl]ethanamine;oxalic acid.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[(5-methylfuran-2-yl)methyl]ethanamine;oxalic acid |
|---|---|
| PubChem CID | 17053061 |
| Molecular Formula | C18H23NO7 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[(5-methylfuran-2-yl)methyl]ethanamine;oxalic acid |
| SMILES | COc1ccc(CCNCc2ccc(C)o2)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H21NO3.C2H2O4/c1-12-4-6-14(20-12)11-17-9-8-13-5-7-15(18-2)16(10-13)19-3;3-1(4)2(5)6/h4-7,10,17H,8-9,11H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | DGUDHCSOJTWRPR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|