C15H24F2N2O2S — CID 119111981
1-[3-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]propyl]piperidin-4-ol (PubChem CID 119111981) has the molecular formula C15H24F2N2O2S and a molecular weight of 334.43 g/mol. Its IUPAC name is 1-[3-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]propyl]piperidin-4-ol.
| Compound Name | 1-[3-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 119111981 |
| Molecular Formula | C15H24F2N2O2S |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-[3-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methylamino]propyl]piperidin-4-ol |
| SMILES | OC1CCN(CCCNCc2ccc(CSC(F)F)o2)CC1 |
| InChI | InChI=1S/C15H24F2N2O2S/c16-15(17)22-11-14-3-2-13(21-14)10-18-6-1-7-19-8-4-12(20)5-9-19/h2-3,12,15,18,20H,1,4-11H2 |
| InChIKey | YHMXHYZKLDUGOV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 48.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|