C19H25ClN2O2 — CID 110929359
1-[3-[[5-(2-chlorophenyl)furan-2-yl]methylamino]propyl]piperidin-4-ol (PubChem CID 110929359) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is 1-[3-[[5-(2-chlorophenyl)furan-2-yl]methylamino]propyl]piperidin-4-ol.
| Compound Name | 1-[3-[[5-(2-chlorophenyl)furan-2-yl]methylamino]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 110929359 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[3-[[5-(2-chlorophenyl)furan-2-yl]methylamino]propyl]piperidin-4-ol |
| SMILES | OC1CCN(CCCNCc2ccc(-c3ccccc3Cl)o2)CC1 |
| InChI | InChI=1S/C19H25ClN2O2/c20-18-5-2-1-4-17(18)19-7-6-16(24-19)14-21-10-3-11-22-12-8-15(23)9-13-22/h1-2,4-7,15,21,23H,3,8-14H2 |
| InChIKey | RLQREFYBOGAHRM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 48.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|