C18H26Cl2N2O2 — CID 6456966
3-morpholin-4-yl-N-[(5-phenylfuran-2-yl)methyl]propan-1-amine;dihydrochloride (PubChem CID 6456966) has the molecular formula C18H26Cl2N2O2 and a molecular weight of 373.32 g/mol. Its IUPAC name is 3-morpholin-4-yl-N-[(5-phenylfuran-2-yl)methyl]propan-1-amine;dihydrochloride.
| Compound Name | 3-morpholin-4-yl-N-[(5-phenylfuran-2-yl)methyl]propan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 6456966 |
| Molecular Formula | C18H26Cl2N2O2 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 3-morpholin-4-yl-N-[(5-phenylfuran-2-yl)methyl]propan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(-c2ccc(CNCCCN3CCOCC3)o2)cc1 |
| InChI | InChI=1S/C18H24N2O2.2ClH/c1-2-5-16(6-3-1)18-8-7-17(22-18)15-19-9-4-10-20-11-13-21-14-12-20;;/h1-3,5-8,19H,4,9-15H2;2*1H |
| InChIKey | VCMIWVBLNOYXQT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|