C17H19N3O — CID 17156318
3-imidazol-1-yl-N-[(5-phenylfuran-2-yl)methyl]propan-1-amine (PubChem CID 17156318) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-[(5-phenylfuran-2-yl)methyl]propan-1-amine.
| Compound Name | 3-imidazol-1-yl-N-[(5-phenylfuran-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 17156318 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 3-imidazol-1-yl-N-[(5-phenylfuran-2-yl)methyl]propan-1-amine |
| SMILES | c1ccc(-c2ccc(CNCCCn3ccnc3)o2)cc1 |
| InChI | InChI=1S/C17H19N3O/c1-2-5-15(6-3-1)17-8-7-16(21-17)13-18-9-4-11-20-12-10-19-14-20/h1-3,5-8,10,12,14,18H,4,9,11,13H2 |
| InChIKey | LIEFOVKXVMFJLP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|