C18H21Cl2N3O2 — CID 17156415
N-[[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride (PubChem CID 17156415) has the molecular formula C18H21Cl2N3O2 and a molecular weight of 382.29 g/mol. Its IUPAC name is N-[[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride.
| Compound Name | N-[[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17156415 |
| Molecular Formula | C18H21Cl2N3O2 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-[[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride |
| SMILES | COc1ccc(-c2ccc(CNCCCn3ccnc3)o2)cc1Cl.Cl |
| InChI | InChI=1S/C18H20ClN3O2.ClH/c1-23-18-5-3-14(11-16(18)19)17-6-4-15(24-17)12-20-7-2-9-22-10-8-21-13-22;/h3-6,8,10-11,13,20H,2,7,9,12H2,1H3;1H |
| InChIKey | DBFCFCFWQGNOCE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|