C17H19BrClN3O — CID 17156371
N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride (PubChem CID 17156371) has the molecular formula C17H19BrClN3O and a molecular weight of 396.72 g/mol. Its IUPAC name is N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride.
| Compound Name | N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17156371 |
| Molecular Formula | C17H19BrClN3O |
| Molecular Weight | 396.72 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-imidazol-1-ylpropan-1-amine;hydrochloride |
| SMILES | Brc1ccc(-c2ccc(CNCCCn3ccnc3)o2)cc1.Cl |
| InChI | InChI=1S/C17H18BrN3O.ClH/c18-15-4-2-14(3-5-15)17-7-6-16(22-17)12-19-8-1-10-21-11-9-20-13-21;/h2-7,9,11,13,19H,1,8,10,12H2;1H |
| InChIKey | LUJXXOKOXFAYMP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.72 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|