C23H26N6 — CID 125115068
3-imidazol-1-yl-N-[[2-[(4-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]propan-1-amine (PubChem CID 125115068) has the molecular formula C23H26N6 and a molecular weight of 386.50 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-[[2-[(4-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]propan-1-amine.
| Compound Name | 3-imidazol-1-yl-N-[[2-[(4-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 125115068 |
| Molecular Formula | C23H26N6 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 3-imidazol-1-yl-N-[[2-[(4-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]propan-1-amine |
| SMILES | Cc1ccc(Cn2nc(CNCCCn3ccnc3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H26N6/c1-19-8-10-20(11-9-19)17-29-26-22(23(27-29)21-6-3-2-4-7-21)16-24-12-5-14-28-15-13-25-18-28/h2-4,6-11,13,15,18,24H,5,12,14,16-17H2,1H3 |
| InChIKey | JEGCDOSXJIINCT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|