C20H22Cl2N4O — CID 124787503
4-[[2-[(3,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methylamino]butan-1-ol (PubChem CID 124787503) has the molecular formula C20H22Cl2N4O and a molecular weight of 405.33 g/mol. Its IUPAC name is 4-[[2-[(3,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methylamino]butan-1-ol.
| Compound Name | 4-[[2-[(3,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 124787503 |
| Molecular Formula | C20H22Cl2N4O |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 4-[[2-[(3,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methylamino]butan-1-ol |
| SMILES | OCCCCNCc1nn(Cc2ccc(Cl)c(Cl)c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C20H22Cl2N4O/c21-17-9-8-15(12-18(17)22)14-26-24-19(13-23-10-4-5-11-27)20(25-26)16-6-2-1-3-7-16/h1-3,6-9,12,23,27H,4-5,10-11,13-14H2 |
| InChIKey | QSXVWQXVUQTYCQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|