C24H22Cl2N4 — CID 124895635
N-[[2-[(3,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-phenylethanamine (PubChem CID 124895635) has the molecular formula C24H22Cl2N4 and a molecular weight of 437.37 g/mol. Its IUPAC name is N-[[2-[(3,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-phenylethanamine.
| Compound Name | N-[[2-[(3,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-phenylethanamine |
|---|---|
| PubChem CID | 124895635 |
| Molecular Formula | C24H22Cl2N4 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | N-[[2-[(3,4-dichlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-phenylethanamine |
| SMILES | Clc1ccc(Cn2nc(CNCCc3ccccc3)c(-c3ccccc3)n2)cc1Cl |
| InChI | InChI=1S/C24H22Cl2N4/c25-21-12-11-19(15-22(21)26)17-30-28-23(24(29-30)20-9-5-2-6-10-20)16-27-14-13-18-7-3-1-4-8-18/h1-12,15,27H,13-14,16-17H2 |
| InChIKey | OJLIWOGETZNNPM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|