C23H21ClN4 — CID 124895280
N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-1-phenylmethanamine (PubChem CID 124895280) has the molecular formula C23H21ClN4 and a molecular weight of 388.90 g/mol. Its IUPAC name is N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-1-phenylmethanamine.
| Compound Name | N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 124895280 |
| Molecular Formula | C23H21ClN4 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-1-phenylmethanamine |
| SMILES | Clc1cccc(Cn2nc(CNCc3ccccc3)c(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C23H21ClN4/c24-21-13-7-10-19(14-21)17-28-26-22(16-25-15-18-8-3-1-4-9-18)23(27-28)20-11-5-2-6-12-20/h1-14,25H,15-17H2 |
| InChIKey | FPAVOYOVMHNFDB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |