C20H23ClN4O — CID 124821107
2-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methylamino]-2-methylpropan-1-ol (PubChem CID 124821107) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is 2-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methylamino]-2-methylpropan-1-ol.
| Compound Name | 2-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methylamino]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 124821107 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methylamino]-2-methylpropan-1-ol |
| SMILES | CC(C)(CO)NCc1nn(Cc2cccc(Cl)c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C20H23ClN4O/c1-20(2,14-26)22-12-18-19(16-8-4-3-5-9-16)24-25(23-18)13-15-7-6-10-17(21)11-15/h3-11,22,26H,12-14H2,1-2H3 |
| InChIKey | IXBOGMBSXUSGMF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |