C23H29ClN4 — CID 124826431
N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]heptan-1-amine (PubChem CID 124826431) has the molecular formula C23H29ClN4 and a molecular weight of 396.97 g/mol. Its IUPAC name is N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]heptan-1-amine.
| Compound Name | N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]heptan-1-amine |
|---|---|
| PubChem CID | 124826431 |
| Molecular Formula | C23H29ClN4 |
| Molecular Weight | 396.97 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]heptan-1-amine |
| SMILES | CCCCCCCNCc1nn(Cc2cccc(Cl)c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H29ClN4/c1-2-3-4-5-9-15-25-17-22-23(20-12-7-6-8-13-20)27-28(26-22)18-19-11-10-14-21(24)16-19/h6-8,10-14,16,25H,2-5,9,15,17-18H2,1H3 |
| InChIKey | XSSHBKQYXHGVNR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.97 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|