C23H29ClN4O — CID 124822323
3-butoxy-N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]propan-1-amine (PubChem CID 124822323) has the molecular formula C23H29ClN4O and a molecular weight of 412.97 g/mol. Its IUPAC name is 3-butoxy-N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]propan-1-amine.
| Compound Name | 3-butoxy-N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 124822323 |
| Molecular Formula | C23H29ClN4O |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 3-butoxy-N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCCOCCCNCc1nn(Cc2cccc(Cl)c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H29ClN4O/c1-2-3-14-29-15-8-13-25-17-22-23(20-10-5-4-6-11-20)27-28(26-22)18-19-9-7-12-21(24)16-19/h4-7,9-12,16,25H,2-3,8,13-15,17-18H2,1H3 |
| InChIKey | QTKQEIHZQPASNI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|