C21H27N5 — CID 125114510
N-methyl-N'-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]propane-1,3-diamine (PubChem CID 125114510) has the molecular formula C21H27N5 and a molecular weight of 349.48 g/mol. Its IUPAC name is N-methyl-N'-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]propane-1,3-diamine.
| Compound Name | N-methyl-N'-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 125114510 |
| Molecular Formula | C21H27N5 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | N-methyl-N'-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]propane-1,3-diamine |
| SMILES | CNCCCNCc1nn(Cc2cccc(C)c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H27N5/c1-17-8-6-9-18(14-17)16-26-24-20(15-23-13-7-12-22-2)21(25-26)19-10-4-3-5-11-19/h3-6,8-11,14,22-23H,7,12-13,15-16H2,1-2H3 |
| InChIKey | MTJYWUSZJWPVIT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|