C27H27N5 — CID 125115155
2-(1H-indol-3-yl)-N-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]ethanamine (PubChem CID 125115155) has the molecular formula C27H27N5 and a molecular weight of 421.55 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]ethanamine.
| Compound Name | 2-(1H-indol-3-yl)-N-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 125115155 |
| Molecular Formula | C27H27N5 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]ethanamine |
| SMILES | Cc1cccc(Cn2nc(CNCCc3c[nH]c4ccccc34)c(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C27H27N5/c1-20-8-7-9-21(16-20)19-32-30-26(27(31-32)22-10-3-2-4-11-22)18-28-15-14-23-17-29-25-13-6-5-12-24(23)25/h2-13,16-17,28-29H,14-15,18-19H2,1H3 |
| InChIKey | XOEAKRKVHWLFMF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|