C28H41N5 — CID 125114768
N',N'-dibutyl-N-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]propane-1,3-diamine (PubChem CID 125114768) has the molecular formula C28H41N5 and a molecular weight of 447.67 g/mol. Its IUPAC name is N',N'-dibutyl-N-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]propane-1,3-diamine.
| Compound Name | N',N'-dibutyl-N-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 125114768 |
| Molecular Formula | C28H41N5 |
| Molecular Weight | 447.67 g/mol |
| Exact Mass | 447.34 |
| IUPAC Name | N',N'-dibutyl-N-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]propane-1,3-diamine |
| SMILES | CCCCN(CCCC)CCCNCc1nn(Cc2cccc(C)c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C28H41N5/c1-4-6-18-32(19-7-5-2)20-12-17-29-22-27-28(26-15-9-8-10-16-26)31-33(30-27)23-25-14-11-13-24(3)21-25/h8-11,13-16,21,29H,4-7,12,17-20,22-23H2,1-3H3 |
| InChIKey | WJGACFHAFPRJJQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.67 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|