C27H28N8S — CID 125115087
N-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 125115087) has the molecular formula C27H28N8S and a molecular weight of 496.64 g/mol. Its IUPAC name is N-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 125115087 |
| Molecular Formula | C27H28N8S |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | N-[[2-[(3-methylphenyl)methyl]-5-phenyltriazol-4-yl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | Cc1cccc(Cn2nc(CNCCCSc3nnnn3-c3ccccc3)c(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C27H28N8S/c1-21-10-8-11-22(18-21)20-34-30-25(26(31-34)23-12-4-2-5-13-23)19-28-16-9-17-36-27-29-32-33-35(27)24-14-6-3-7-15-24/h2-8,10-15,18,28H,9,16-17,19-20H2,1H3 |
| InChIKey | KXRHWNORBBYLTP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|