C25H23ClN8S — CID 125114203
N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine (PubChem CID 125114203) has the molecular formula C25H23ClN8S and a molecular weight of 503.04 g/mol. Its IUPAC name is N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine.
| Compound Name | N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 125114203 |
| Molecular Formula | C25H23ClN8S |
| Molecular Weight | 503.04 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | N-[[2-[(3-chlorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
| SMILES | Clc1cccc(Cn2nc(CNCCSc3nnnn3-c3ccccc3)c(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C25H23ClN8S/c26-21-11-7-8-19(16-21)18-33-29-23(24(30-33)20-9-3-1-4-10-20)17-27-14-15-35-25-28-31-32-34(25)22-12-5-2-6-13-22/h1-13,16,27H,14-15,17-18H2 |
| InChIKey | AADGQCSJYLLGGU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.04 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|