C20H20ClN5OS — CID 17060084
N-[(5-phenylfuran-2-yl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride (PubChem CID 17060084) has the molecular formula C20H20ClN5OS and a molecular weight of 413.93 g/mol. Its IUPAC name is N-[(5-phenylfuran-2-yl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride.
| Compound Name | N-[(5-phenylfuran-2-yl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
|---|---|
| PubChem CID | 17060084 |
| Molecular Formula | C20H20ClN5OS |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | N-[(5-phenylfuran-2-yl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
| SMILES | Cl.c1ccc(-c2ccc(CNCCSc3nnnn3-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C20H19N5OS.ClH/c1-3-7-16(8-4-1)19-12-11-18(26-19)15-21-13-14-27-20-22-23-24-25(20)17-9-5-2-6-10-17;/h1-12,21H,13-15H2;1H |
| InChIKey | DXBYKEGLUUPHAY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|