C19H22ClN5OS — CID 17296091
2-(1-phenyltetrazol-5-yl)sulfanyl-N-[(4-prop-2-enoxyphenyl)methyl]ethanamine;hydrochloride (PubChem CID 17296091) has the molecular formula C19H22ClN5OS and a molecular weight of 403.94 g/mol. Its IUPAC name is 2-(1-phenyltetrazol-5-yl)sulfanyl-N-[(4-prop-2-enoxyphenyl)methyl]ethanamine;hydrochloride.
| Compound Name | 2-(1-phenyltetrazol-5-yl)sulfanyl-N-[(4-prop-2-enoxyphenyl)methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17296091 |
| Molecular Formula | C19H22ClN5OS |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 2-(1-phenyltetrazol-5-yl)sulfanyl-N-[(4-prop-2-enoxyphenyl)methyl]ethanamine;hydrochloride |
| SMILES | C=CCOc1ccc(CNCCSc2nnnn2-c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C19H21N5OS.ClH/c1-2-13-25-18-10-8-16(9-11-18)15-20-12-14-26-19-21-22-23-24(19)17-6-4-3-5-7-17;/h2-11,20H,1,12-15H2;1H |
| InChIKey | ONQXZGZKBKWQCK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|