C13H16N6S2 — CID 7573949
1-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]-3-prop-2-enylthiourea (PubChem CID 7573949) has the molecular formula C13H16N6S2 and a molecular weight of 320.45 g/mol. Its IUPAC name is 1-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]-3-prop-2-enylthiourea.
| Compound Name | 1-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 7573949 |
| Molecular Formula | C13H16N6S2 |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NCCSc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C13H16N6S2/c1-2-8-14-12(20)15-9-10-21-13-16-17-18-19(13)11-6-4-3-5-7-11/h2-7H,1,8-10H2,(H2,14,15,20) |
| InChIKey | CUZRPTTXYFVUIT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|