C13H20N6S — CID 62578094
N',N'-dimethyl-N-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]ethane-1,2-diamine (PubChem CID 62578094) has the molecular formula C13H20N6S and a molecular weight of 292.41 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62578094 |
| Molecular Formula | C13H20N6S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | N',N'-dimethyl-N-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNCCSc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C13H20N6S/c1-18(2)10-8-14-9-11-20-13-15-16-17-19(13)12-6-4-3-5-7-12/h3-7,14H,8-11H2,1-2H3 |
| InChIKey | FHBDWLVAAIVUBJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|