C19H23N5O3S — CID 6485916
2-(1-phenyltetrazol-5-yl)sulfanyl-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine (PubChem CID 6485916) has the molecular formula C19H23N5O3S and a molecular weight of 401.49 g/mol. Its IUPAC name is 2-(1-phenyltetrazol-5-yl)sulfanyl-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine.
| Compound Name | 2-(1-phenyltetrazol-5-yl)sulfanyl-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 6485916 |
| Molecular Formula | C19H23N5O3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 2-(1-phenyltetrazol-5-yl)sulfanyl-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine |
| SMILES | COc1cc(CNCCSc2nnnn2-c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H23N5O3S/c1-25-16-11-14(12-17(26-2)18(16)27-3)13-20-9-10-28-19-21-22-23-24(19)15-7-5-4-6-8-15/h4-8,11-12,20H,9-10,13H2,1-3H3 |
| InChIKey | DQNNJRGJIVBHST-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|