C25H28ClN5O2S — CID 17333569
N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride (PubChem CID 17333569) has the molecular formula C25H28ClN5O2S and a molecular weight of 498.05 g/mol. Its IUPAC name is N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride.
| Compound Name | N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17333569 |
| Molecular Formula | C25H28ClN5O2S |
| Molecular Weight | 498.05 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine;hydrochloride |
| SMILES | COc1cc(CNCCCSc2nnnn2-c2ccccc2)ccc1OCc1ccccc1.Cl |
| InChI | InChI=1S/C25H27N5O2S.ClH/c1-31-24-17-21(13-14-23(24)32-19-20-9-4-2-5-10-20)18-26-15-8-16-33-25-27-28-29-30(25)22-11-6-3-7-12-22;/h2-7,9-14,17,26H,8,15-16,18-19H2,1H3;1H |
| InChIKey | IZDODSAWTJVQGJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.05 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|