C23H23Cl2N5OS — CID 17158638
N-[(3-chloro-4-phenylmethoxyphenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride (PubChem CID 17158638) has the molecular formula C23H23Cl2N5OS and a molecular weight of 488.44 g/mol. Its IUPAC name is N-[(3-chloro-4-phenylmethoxyphenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride.
| Compound Name | N-[(3-chloro-4-phenylmethoxyphenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
|---|---|
| PubChem CID | 17158638 |
| Molecular Formula | C23H23Cl2N5OS |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | N-[(3-chloro-4-phenylmethoxyphenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
| SMILES | Cl.Clc1cc(CNCCSc2nnnn2-c2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H22ClN5OS.ClH/c24-21-15-19(11-12-22(21)30-17-18-7-3-1-4-8-18)16-25-13-14-31-23-26-27-28-29(23)20-9-5-2-6-10-20;/h1-12,15,25H,13-14,16-17H2;1H |
| InChIKey | SQPFXKMIQAPTOR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|