C20H24ClN5OS — CID 29222530
N-[(3-chloro-4-propoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 29222530) has the molecular formula C20H24ClN5OS and a molecular weight of 417.97 g/mol. Its IUPAC name is N-[(3-chloro-4-propoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[(3-chloro-4-propoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 29222530 |
| Molecular Formula | C20H24ClN5OS |
| Molecular Weight | 417.97 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N-[(3-chloro-4-propoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | CCCOc1ccc(CNCCCSc2nnnn2-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C20H24ClN5OS/c1-2-12-27-19-10-9-16(14-18(19)21)15-22-11-6-13-28-20-23-24-25-26(20)17-7-4-3-5-8-17/h3-5,7-10,14,22H,2,6,11-13,15H2,1H3 |
| InChIKey | OYKPVFFIZWHKRZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.97 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|