C17H17Cl2N5S — CID 4725371
N-[(3,4-dichlorophenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 4725371) has the molecular formula C17H17Cl2N5S and a molecular weight of 394.33 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 4725371 |
| Molecular Formula | C17H17Cl2N5S |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | Clc1ccc(CNCCCSc2nnnn2-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C17H17Cl2N5S/c18-15-8-7-13(11-16(15)19)12-20-9-4-10-25-17-21-22-23-24(17)14-5-2-1-3-6-14/h1-3,5-8,11,20H,4,9-10,12H2 |
| InChIKey | VIMOXBPEQPXMLK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|