C24H23N9OS — CID 17212372
N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 17212372) has the molecular formula C24H23N9OS and a molecular weight of 485.58 g/mol. Its IUPAC name is N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 17212372 |
| Molecular Formula | C24H23N9OS |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | c1ccc(-n2nnnc2Oc2cccc(CNCCCSc3nnnn3-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H23N9OS/c1-3-10-20(11-4-1)32-23(26-28-30-32)34-22-14-7-9-19(17-22)18-25-15-8-16-35-24-27-29-31-33(24)21-12-5-2-6-13-21/h1-7,9-14,17,25H,8,15-16,18H2 |
| InChIKey | BUPSUBZRWILNLT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|