C22H19N5O3 — CID 17206285
4-[[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]methyl]benzoic acid (PubChem CID 17206285) has the molecular formula C22H19N5O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is 4-[[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]methyl]benzoic acid.
| Compound Name | 4-[[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 17206285 |
| Molecular Formula | C22H19N5O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 4-[[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCc2cccc(Oc3nnnn3-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C22H19N5O3/c28-21(29)18-11-9-16(10-12-18)14-23-15-17-5-4-8-20(13-17)30-22-24-25-26-27(22)19-6-2-1-3-7-19/h1-13,23H,14-15H2,(H,28,29) |
| InChIKey | NCWGSJYMSRAMRZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |