C23H21N5O3 — CID 66539015
ethyl 4-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]benzoate (PubChem CID 66539015) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is ethyl 4-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]benzoate.
| Compound Name | ethyl 4-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]benzoate |
|---|---|
| PubChem CID | 66539015 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | ethyl 4-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NCc2cccc(Oc3nnnn3-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H21N5O3/c1-2-30-22(29)18-11-13-19(14-12-18)24-16-17-7-6-10-21(15-17)31-23-25-26-27-28(23)20-8-4-3-5-9-20/h3-15,24H,2,16H2,1H3 |
| InChIKey | DLPWNXKCDVNNSZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |