C22H21N7O3 — CID 17212362
N'-(4-nitrophenyl)-N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethane-1,2-diamine (PubChem CID 17212362) has the molecular formula C22H21N7O3 and a molecular weight of 431.46 g/mol. Its IUPAC name is N'-(4-nitrophenyl)-N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethane-1,2-diamine.
| Compound Name | N'-(4-nitrophenyl)-N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 17212362 |
| Molecular Formula | C22H21N7O3 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N'-(4-nitrophenyl)-N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCCNCc2cccc(Oc3nnnn3-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C22H21N7O3/c30-29(31)20-11-9-18(10-12-20)24-14-13-23-16-17-5-4-8-21(15-17)32-22-25-26-27-28(22)19-6-2-1-3-7-19/h1-12,15,23-24H,13-14,16H2 |
| InChIKey | IBZXAIXDYMYMSY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|