C18H20ClN9OS — CID 17206272
2-(1-methyltetrazol-5-yl)sulfanyl-N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethanamine;hydrochloride (PubChem CID 17206272) has the molecular formula C18H20ClN9OS and a molecular weight of 445.94 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanyl-N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethanamine;hydrochloride.
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17206272 |
| Molecular Formula | C18H20ClN9OS |
| Molecular Weight | 445.94 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-[[3-(1-phenyltetrazol-5-yl)oxyphenyl]methyl]ethanamine;hydrochloride |
| SMILES | Cl.Cn1nnnc1SCCNCc1cccc(Oc2nnnn2-c2ccccc2)c1 |
| InChI | InChI=1S/C18H19N9OS.ClH/c1-26-18(21-23-24-26)29-11-10-19-13-14-6-5-9-16(12-14)28-17-20-22-25-27(17)15-7-3-2-4-8-15;/h2-9,12,19H,10-11,13H2,1H3;1H |
| InChIKey | JIICOPCJLWMFEF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.94 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|