C16H17ClN6O2S — CID 17333301
N-[(3-nitrophenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride (PubChem CID 17333301) has the molecular formula C16H17ClN6O2S and a molecular weight of 392.87 g/mol. Its IUPAC name is N-[(3-nitrophenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride.
| Compound Name | N-[(3-nitrophenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
|---|---|
| PubChem CID | 17333301 |
| Molecular Formula | C16H17ClN6O2S |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | N-[(3-nitrophenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cccc(CNCCSc2nnnn2-c2ccccc2)c1 |
| InChI | InChI=1S/C16H16N6O2S.ClH/c23-22(24)15-8-4-5-13(11-15)12-17-9-10-25-16-18-19-20-21(16)14-6-2-1-3-7-14;/h1-8,11,17H,9-10,12H2;1H |
| InChIKey | MDJJMGNCPKOUIX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|