C11H14N6O2S — CID 4719571
2-(1-methyltetrazol-5-yl)sulfanyl-N-[(3-nitrophenyl)methyl]ethanamine (PubChem CID 4719571) has the molecular formula C11H14N6O2S and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanyl-N-[(3-nitrophenyl)methyl]ethanamine.
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-[(3-nitrophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 4719571 |
| Molecular Formula | C11H14N6O2S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-[(3-nitrophenyl)methyl]ethanamine |
| SMILES | Cn1nnnc1SCCNCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H14N6O2S/c1-16-11(13-14-15-16)20-6-5-12-8-9-3-2-4-10(7-9)17(18)19/h2-4,7,12H,5-6,8H2,1H3 |
| InChIKey | TZYAZKBYJLLSGS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|