C15H25ClN6S — CID 6458712
N,N-diethyl-4-[[2-(1-methyltetrazol-5-yl)sulfanylethylamino]methyl]aniline;hydrochloride (PubChem CID 6458712) has the molecular formula C15H25ClN6S and a molecular weight of 356.93 g/mol. Its IUPAC name is N,N-diethyl-4-[[2-(1-methyltetrazol-5-yl)sulfanylethylamino]methyl]aniline;hydrochloride.
| Compound Name | N,N-diethyl-4-[[2-(1-methyltetrazol-5-yl)sulfanylethylamino]methyl]aniline;hydrochloride |
|---|---|
| PubChem CID | 6458712 |
| Molecular Formula | C15H25ClN6S |
| Molecular Weight | 356.93 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N,N-diethyl-4-[[2-(1-methyltetrazol-5-yl)sulfanylethylamino]methyl]aniline;hydrochloride |
| SMILES | CCN(CC)c1ccc(CNCCSc2nnnn2C)cc1.Cl |
| InChI | InChI=1S/C15H24N6S.ClH/c1-4-21(5-2)14-8-6-13(7-9-14)12-16-10-11-22-15-17-18-19-20(15)3;/h6-9,16H,4-5,10-12H2,1-3H3;1H |
| InChIKey | ZQQDXHHLDYKIHD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.93 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|