C13H18ClN5O2S — CID 17158726
4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]benzoic acid;hydrochloride (PubChem CID 17158726) has the molecular formula C13H18ClN5O2S and a molecular weight of 343.84 g/mol. Its IUPAC name is 4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]benzoic acid;hydrochloride.
| Compound Name | 4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 17158726 |
| Molecular Formula | C13H18ClN5O2S |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]benzoic acid;hydrochloride |
| SMILES | Cl.Cn1nnnc1SCCCNCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C13H17N5O2S.ClH/c1-18-13(15-16-17-18)21-8-2-7-14-9-10-3-5-11(6-4-10)12(19)20;/h3-6,14H,2,7-9H2,1H3,(H,19,20);1H |
| InChIKey | OPZZTCZXGJUIND-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|