C15H23ClN6O3S — CID 17053376
2-[2-methoxy-6-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]phenoxy]acetamide;hydrochloride (PubChem CID 17053376) has the molecular formula C15H23ClN6O3S and a molecular weight of 402.91 g/mol. Its IUPAC name is 2-[2-methoxy-6-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]phenoxy]acetamide;hydrochloride.
| Compound Name | 2-[2-methoxy-6-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]phenoxy]acetamide;hydrochloride |
|---|---|
| PubChem CID | 17053376 |
| Molecular Formula | C15H23ClN6O3S |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-[2-methoxy-6-[[3-(1-methyltetrazol-5-yl)sulfanylpropylamino]methyl]phenoxy]acetamide;hydrochloride |
| SMILES | COc1cccc(CNCCCSc2nnnn2C)c1OCC(N)=O.Cl |
| InChI | InChI=1S/C15H22N6O3S.ClH/c1-21-15(18-19-20-21)25-8-4-7-17-9-11-5-3-6-12(23-2)14(11)24-10-13(16)22;/h3,5-6,17H,4,7-10H2,1-2H3,(H2,16,22);1H |
| InChIKey | REMDIXLMRGCAEK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|