C14H19BrN6O3S — CID 4718576
2-[2-bromo-6-methoxy-4-[[2-(1-methyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]acetamide (PubChem CID 4718576) has the molecular formula C14H19BrN6O3S and a molecular weight of 431.32 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-[[2-(1-methyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]acetamide.
| Compound Name | 2-[2-bromo-6-methoxy-4-[[2-(1-methyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 4718576 |
| Molecular Formula | C14H19BrN6O3S |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-[[2-(1-methyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]acetamide |
| SMILES | COc1cc(CNCCSc2nnnn2C)cc(Br)c1OCC(N)=O |
| InChI | InChI=1S/C14H19BrN6O3S/c1-21-14(18-19-20-21)25-4-3-17-7-9-5-10(15)13(11(6-9)23-2)24-8-12(16)22/h5-6,17H,3-4,7-8H2,1-2H3,(H2,16,22) |
| InChIKey | NYAFFOKTQAFVKJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|