C19H22BrClN5O2S- — CID 53351267
N-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine chloride (PubChem CID 53351267) has the molecular formula C19H22BrClN5O2S- and a molecular weight of 499.84 g/mol. Its IUPAC name is N-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine chloride.
| Compound Name | N-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine chloride |
|---|---|
| PubChem CID | 53351267 |
| Molecular Formula | C19H22BrClN5O2S- |
| Molecular Weight | 499.84 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | N-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine chloride |
| SMILES | COc1cc(CNCCSc2nnnn2C)cc(Br)c1OCc1ccccc1.[Cl-] |
| InChI | InChI=1S/C19H22BrN5O2S.ClH/c1-25-19(22-23-24-25)28-9-8-21-12-15-10-16(20)18(17(11-15)26-2)27-13-14-6-4-3-5-7-14;/h3-7,10-11,21H,8-9,12-13H2,1-2H3;1H/p-1 |
| InChIKey | VEVJBLINPZSENK-UHFFFAOYSA-M |
| XLogP | 0.45 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.84 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|