C20H25BrClN5O2S — CID 11948812
N-[(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine;hydrochloride (PubChem CID 11948812) has the molecular formula C20H25BrClN5O2S and a molecular weight of 514.88 g/mol. Its IUPAC name is N-[(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine;hydrochloride.
| Compound Name | N-[(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
|---|---|
| PubChem CID | 11948812 |
| Molecular Formula | C20H25BrClN5O2S |
| Molecular Weight | 514.88 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | N-[(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)methyl]-2-(1-methyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
| SMILES | CCOc1cc(CNCCSc2nnnn2C)cc(Br)c1OCc1ccccc1.Cl |
| InChI | InChI=1S/C20H24BrN5O2S.ClH/c1-3-27-18-12-16(13-22-9-10-29-20-23-24-25-26(20)2)11-17(21)19(18)28-14-15-7-5-4-6-8-15;/h4-8,11-12,22H,3,9-10,13-14H2,1-2H3;1H |
| InChIKey | BRPDNRLAVLSBMZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.88 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|