C20H24BrClN6O3S — CID 17333267
2-[2-bromo-6-ethoxy-4-[[2-(1-phenyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]acetamide;hydrochloride (PubChem CID 17333267) has the molecular formula C20H24BrClN6O3S and a molecular weight of 543.88 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-[[2-(1-phenyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]acetamide;hydrochloride.
| Compound Name | 2-[2-bromo-6-ethoxy-4-[[2-(1-phenyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]acetamide;hydrochloride |
|---|---|
| PubChem CID | 17333267 |
| Molecular Formula | C20H24BrClN6O3S |
| Molecular Weight | 543.88 g/mol |
| Exact Mass | 542.05 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-[[2-(1-phenyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]acetamide;hydrochloride |
| SMILES | CCOc1cc(CNCCSc2nnnn2-c2ccccc2)cc(Br)c1OCC(N)=O.Cl |
| InChI | InChI=1S/C20H23BrN6O3S.ClH/c1-2-29-17-11-14(10-16(21)19(17)30-13-18(22)28)12-23-8-9-31-20-24-25-26-27(20)15-6-4-3-5-7-15;/h3-7,10-11,23H,2,8-9,12-13H2,1H3,(H2,22,28);1H |
| InChIKey | GOJLZXYFGWTUFY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.88 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|