C20H23ClN6O3S — CID 4724748
2-[2-chloro-6-ethoxy-4-[[2-(1-phenyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]acetamide (PubChem CID 4724748) has the molecular formula C20H23ClN6O3S and a molecular weight of 462.96 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[[2-(1-phenyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[[2-(1-phenyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 4724748 |
| Molecular Formula | C20H23ClN6O3S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[[2-(1-phenyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(CNCCSc2nnnn2-c2ccccc2)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C20H23ClN6O3S/c1-2-29-17-11-14(10-16(21)19(17)30-13-18(22)28)12-23-8-9-31-20-24-25-26-27(20)15-6-4-3-5-7-15/h3-7,10-11,23H,2,8-9,12-13H2,1H3,(H2,22,28) |
| InChIKey | HXPPGCNAOXULRP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|