C21H26ClN5O2S — CID 17296090
N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride (PubChem CID 17296090) has the molecular formula C21H26ClN5O2S and a molecular weight of 447.99 g/mol. Its IUPAC name is N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride.
| Compound Name | N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
|---|---|
| PubChem CID | 17296090 |
| Molecular Formula | C21H26ClN5O2S |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine;hydrochloride |
| SMILES | C=CCOc1ccc(CNCCSc2nnnn2-c2ccccc2)cc1OCC.Cl |
| InChI | InChI=1S/C21H25N5O2S.ClH/c1-3-13-28-19-11-10-17(15-20(19)27-4-2)16-22-12-14-29-21-23-24-25-26(21)18-8-6-5-7-9-18;/h3,5-11,15,22H,1,4,12-14,16H2,2H3;1H |
| InChIKey | YVLCPANUFNEZSQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|