C22H28N5O2S+ — CID 8639631
(3-ethoxy-4-prop-2-enoxyphenyl)methyl-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]azanium (PubChem CID 8639631) has the molecular formula C22H28N5O2S+ and a molecular weight of 426.57 g/mol. Its IUPAC name is (3-ethoxy-4-prop-2-enoxyphenyl)methyl-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]azanium.
| Compound Name | (3-ethoxy-4-prop-2-enoxyphenyl)methyl-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]azanium |
|---|---|
| PubChem CID | 8639631 |
| Molecular Formula | C22H28N5O2S+ |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | (3-ethoxy-4-prop-2-enoxyphenyl)methyl-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]azanium |
| SMILES | C=CCOc1ccc(C[NH2+]CCCSc2nnnn2-c2ccccc2)cc1OCC |
| InChI | InChI=1S/C22H27N5O2S/c1-3-14-29-20-12-11-18(16-21(20)28-4-2)17-23-13-8-15-30-22-24-25-26-27(22)19-9-6-5-7-10-19/h3,5-7,9-12,16,23H,1,4,8,13-15,17H2,2H3/p+1 |
| InChIKey | MJDVHOWZVFWYGB-UHFFFAOYSA-O |
| XLogP | 2.87 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|