C19H23N6O3S+ — CID 8638256
[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]azanium (PubChem CID 8638256) has the molecular formula C19H23N6O3S+ and a molecular weight of 415.50 g/mol. Its IUPAC name is [4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]azanium.
| Compound Name | [4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]azanium |
|---|---|
| PubChem CID | 8638256 |
| Molecular Formula | C19H23N6O3S+ |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]azanium |
| SMILES | COc1cc(C[NH2+]CCSc2nnnn2-c2ccccc2)ccc1OCC(N)=O |
| InChI | InChI=1S/C19H22N6O3S/c1-27-17-11-14(7-8-16(17)28-13-18(20)26)12-21-9-10-29-19-22-23-24-25(19)15-5-3-2-4-6-15/h2-8,11,21H,9-10,12-13H2,1H3,(H2,20,26)/p+1 |
| InChIKey | SDTXCMLVNOMCAF-UHFFFAOYSA-O |
| XLogP | 0.39 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|