C20H26N5O2S+ — CID 8639643
(4-ethoxy-3-methoxyphenyl)methyl-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]azanium (PubChem CID 8639643) has the molecular formula C20H26N5O2S+ and a molecular weight of 400.53 g/mol. Its IUPAC name is (4-ethoxy-3-methoxyphenyl)methyl-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]azanium.
| Compound Name | (4-ethoxy-3-methoxyphenyl)methyl-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]azanium |
|---|---|
| PubChem CID | 8639643 |
| Molecular Formula | C20H26N5O2S+ |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (4-ethoxy-3-methoxyphenyl)methyl-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]azanium |
| SMILES | CCOc1ccc(C[NH2+]CCCSc2nnnn2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C20H25N5O2S/c1-3-27-18-11-10-16(14-19(18)26-2)15-21-12-7-13-28-20-22-23-24-25(20)17-8-5-4-6-9-17/h4-6,8-11,14,21H,3,7,12-13,15H2,1-2H3/p+1 |
| InChIKey | QGUDFTVZPZNTLJ-UHFFFAOYSA-O |
| XLogP | 2.32 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|