C20H24BrN5O2S — CID 4725109
N-[(3-bromo-5-ethoxy-4-methoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 4725109) has the molecular formula C20H24BrN5O2S and a molecular weight of 478.42 g/mol. Its IUPAC name is N-[(3-bromo-5-ethoxy-4-methoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[(3-bromo-5-ethoxy-4-methoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 4725109 |
| Molecular Formula | C20H24BrN5O2S |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | N-[(3-bromo-5-ethoxy-4-methoxyphenyl)methyl]-3-(1-phenyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | CCOc1cc(CNCCCSc2nnnn2-c2ccccc2)cc(Br)c1OC |
| InChI | InChI=1S/C20H24BrN5O2S/c1-3-28-18-13-15(12-17(21)19(18)27-2)14-22-10-7-11-29-20-23-24-25-26(20)16-8-5-4-6-9-16/h4-6,8-9,12-13,22H,3,7,10-11,14H2,1-2H3 |
| InChIKey | RXKFTCLIVOSISG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|